C15H21N3O4S — CID 134034377
N-(5-methylhexan-2-yl)-2,4-dioxo-1H-quinazoline-6-sulfonamide (PubChem CID 134034377) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(5-methylhexan-2-yl)-2,4-dioxo-1H-quinazoline-6-sulfonamide.
| Compound Name | N-(5-methylhexan-2-yl)-2,4-dioxo-1H-quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 134034377 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(5-methylhexan-2-yl)-2,4-dioxo-1H-quinazoline-6-sulfonamide |
| SMILES | CC(C)CCC(C)NS(=O)(=O)c1ccc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C15H21N3O4S/c1-9(2)4-5-10(3)18-23(21,22)11-6-7-13-12(8-11)14(19)17-15(20)16-13/h6-10,18H,4-5H2,1-3H3,(H2,16,17,19,20) |
| InChIKey | JKYBEYQMYSXTBU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |