C16H20N2O5S — CID 97307678
2-[3-[(2R)-2-methylmorpholin-4-yl]sulfonylpropyl]isoindole-1,3-dione (PubChem CID 97307678) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[3-[(2R)-2-methylmorpholin-4-yl]sulfonylpropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2R)-2-methylmorpholin-4-yl]sulfonylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 97307678 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[3-[(2R)-2-methylmorpholin-4-yl]sulfonylpropyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1CN(S(=O)(=O)CCCN2C(=O)c3ccccc3C2=O)CCO1 |
| InChI | InChI=1S/C16H20N2O5S/c1-12-11-17(8-9-23-12)24(21,22)10-4-7-18-15(19)13-5-2-3-6-14(13)16(18)20/h2-3,5-6,12H,4,7-11H2,1H3/t12-/m1/s1 |
| InChIKey | KNINYVGJXXXMOJ-GFCCVEGCSA-N |
| XLogP | 0.72 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|