C17H20N2O4 — CID 46674460
2-[4-(2-methylmorpholin-4-yl)-4-oxobutyl]isoindole-1,3-dione (PubChem CID 46674460) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[4-(2-methylmorpholin-4-yl)-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(2-methylmorpholin-4-yl)-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46674460 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[4-(2-methylmorpholin-4-yl)-4-oxobutyl]isoindole-1,3-dione |
| SMILES | CC1CN(C(=O)CCCN2C(=O)c3ccccc3C2=O)CCO1 |
| InChI | InChI=1S/C17H20N2O4/c1-12-11-18(9-10-23-12)15(20)7-4-8-19-16(21)13-5-2-3-6-14(13)17(19)22/h2-3,5-6,12H,4,7-11H2,1H3 |
| InChIKey | PWQXCQUWYPERNH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|