C18H26N4O4S — CID 120706456
3-(1,3-dioxoisoindol-2-yl)-N-(3-piperazin-1-ylpropyl)propane-1-sulfonamide (PubChem CID 120706456) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(3-piperazin-1-ylpropyl)propane-1-sulfonamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(3-piperazin-1-ylpropyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 120706456 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(3-piperazin-1-ylpropyl)propane-1-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1CCCS(=O)(=O)NCCCN1CCNCC1 |
| InChI | InChI=1S/C18H26N4O4S/c23-17-15-5-1-2-6-16(15)18(24)22(17)11-4-14-27(25,26)20-7-3-10-21-12-8-19-9-13-21/h1-2,5-6,19-20H,3-4,7-14H2 |
| InChIKey | WQCXPGQROUHJPG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|