C11H22F3N3O2S — CID 83068022
4,4,4-trifluoro-N-(3-piperazin-1-ylpropyl)butane-1-sulfonamide (PubChem CID 83068022) has the molecular formula C11H22F3N3O2S and a molecular weight of 317.38 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(3-piperazin-1-ylpropyl)butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-(3-piperazin-1-ylpropyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 83068022 |
| Molecular Formula | C11H22F3N3O2S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4,4,4-trifluoro-N-(3-piperazin-1-ylpropyl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCCCN1CCNCC1 |
| InChI | InChI=1S/C11H22F3N3O2S/c12-11(13,14)3-1-10-20(18,19)16-4-2-7-17-8-5-15-6-9-17/h15-16H,1-10H2 |
| InChIKey | YORLLTPYCYSALM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|