C11H21F3N2O2S — CID 115522833
4-(cyclopropylamino)-N-(4,4,4-trifluorobutyl)butane-1-sulfonamide (PubChem CID 115522833) has the molecular formula C11H21F3N2O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-(4,4,4-trifluorobutyl)butane-1-sulfonamide.
| Compound Name | 4-(cyclopropylamino)-N-(4,4,4-trifluorobutyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 115522833 |
| Molecular Formula | C11H21F3N2O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-(cyclopropylamino)-N-(4,4,4-trifluorobutyl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCNC1CC1)NCCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2S/c12-11(13,14)6-3-8-16-19(17,18)9-2-1-7-15-10-4-5-10/h10,15-16H,1-9H2 |
| InChIKey | YBZMKGNORCDZFB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|