C13H24F3N — CID 79039992
4-propyl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine (PubChem CID 79039992) has the molecular formula C13H24F3N and a molecular weight of 251.34 g/mol. Its IUPAC name is 4-propyl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine.
| Compound Name | 4-propyl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 79039992 |
| Molecular Formula | C13H24F3N |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 4-propyl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine |
| SMILES | CCCC1CCC(NCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3N/c1-2-4-11-5-7-12(8-6-11)17-10-3-9-13(14,15)16/h11-12,17H,2-10H2,1H3 |
| InChIKey | SLXSICMRZMDPFR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|