C15H28F3N — CID 115516563
4-tert-butyl-N-(4,4,4-trifluorobutyl)cycloheptan-1-amine (PubChem CID 115516563) has the molecular formula C15H28F3N and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-tert-butyl-N-(4,4,4-trifluorobutyl)cycloheptan-1-amine.
| Compound Name | 4-tert-butyl-N-(4,4,4-trifluorobutyl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 115516563 |
| Molecular Formula | C15H28F3N |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 4-tert-butyl-N-(4,4,4-trifluorobutyl)cycloheptan-1-amine |
| SMILES | CC(C)(C)C1CCCC(NCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H28F3N/c1-14(2,3)12-6-4-7-13(9-8-12)19-11-5-10-15(16,17)18/h12-13,19H,4-11H2,1-3H3 |
| InChIKey | VPGGBQORPLBWLU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|