About 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol
5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol (PubChem CID 106144752) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol |
| PubChem CID | 106144752 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNC1CCCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H37NO/c1-17(2,3)15-8-6-9-16(11-10-15)19-14-18(4,5)12-7-13-20/h15-16,19-20H,6-14H2,1-5H3 |
| InChIKey | RRUDVLMJLCHWHK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol?
The IUPAC name of 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol (CID 106144752) is 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol?
The canonical SMILES for 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol is CC(C)(CCCO)CNC1CCCC(C(C)(C)C)CC1.
What is the InChIKey of 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol?
The InChIKey is RRUDVLMJLCHWHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO/c1-17(2,3)15-8-6-9-16(11-10-15)19-14-18(4,5)12-7-13-20/h15-16,19-20H,6-14H2,1-5H3.
What are the key properties of 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol?
5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol has a molecular weight of 283.50 g/mol, XLogP of 4.37, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-tert-butylcycloheptyl)amino]-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 106144752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).