C14H26F3N — CID 177148467
4-(2-methylpropyl)-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine (PubChem CID 177148467) has the molecular formula C14H26F3N and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-(2-methylpropyl)-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine.
| Compound Name | 4-(2-methylpropyl)-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 177148467 |
| Molecular Formula | C14H26F3N |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 4-(2-methylpropyl)-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine |
| SMILES | CC(C)CC1CCC(NCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H26F3N/c1-11(2)10-12-4-6-13(7-5-12)18-9-3-8-14(15,16)17/h11-13,18H,3-10H2,1-2H3 |
| InChIKey | WHQMYUWSWIETEA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|