C14H25F3N2 — CID 81343467
1-(3-methylbut-2-enyl)-N-(4,4,4-trifluorobutyl)piperidin-4-amine (PubChem CID 81343467) has the molecular formula C14H25F3N2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-N-(4,4,4-trifluorobutyl)piperidin-4-amine.
| Compound Name | 1-(3-methylbut-2-enyl)-N-(4,4,4-trifluorobutyl)piperidin-4-amine |
|---|---|
| PubChem CID | 81343467 |
| Molecular Formula | C14H25F3N2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-N-(4,4,4-trifluorobutyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(NCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H25F3N2/c1-12(2)4-9-19-10-5-13(6-11-19)18-8-3-7-14(15,16)17/h4,13,18H,3,5-11H2,1-2H3 |
| InChIKey | RIFGRUUJXGTUJZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|