C13H24F3N3O — CID 81343649
N,N-dimethyl-2-[4-(4,4,4-trifluorobutylamino)piperidin-1-yl]acetamide (PubChem CID 81343649) has the molecular formula C13H24F3N3O and a molecular weight of 295.35 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(4,4,4-trifluorobutylamino)piperidin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[4-(4,4,4-trifluorobutylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 81343649 |
| Molecular Formula | C13H24F3N3O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N,N-dimethyl-2-[4-(4,4,4-trifluorobutylamino)piperidin-1-yl]acetamide |
| SMILES | CN(C)C(=O)CN1CCC(NCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3N3O/c1-18(2)12(20)10-19-8-4-11(5-9-19)17-7-3-6-13(14,15)16/h11,17H,3-10H2,1-2H3 |
| InChIKey | NWFDGOHXIBPGSC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|