C15H27N3O — CID 103903646
2-[4-(hex-5-ynylamino)piperidin-1-yl]-N,N-dimethylacetamide (PubChem CID 103903646) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[4-(hex-5-ynylamino)piperidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(hex-5-ynylamino)piperidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 103903646 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 2-[4-(hex-5-ynylamino)piperidin-1-yl]-N,N-dimethylacetamide |
| SMILES | C#CCCCCNC1CCN(CC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C15H27N3O/c1-4-5-6-7-10-16-14-8-11-18(12-9-14)13-15(19)17(2)3/h1,14,16H,5-13H2,2-3H3 |
| InChIKey | JFBQJGOTFANFKV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|