About 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide
2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide (PubChem CID 113303615) has the molecular formula C11H21F2N3O
and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide |
| PubChem CID | 113303615 |
| Molecular Formula | C11H21F2N3O |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCC(NCC(F)F)CC1 |
| InChI | InChI=1S/C11H21F2N3O/c1-15(2)11(17)8-16-5-3-9(4-6-16)14-7-10(12)13/h9-10,14H,3-8H2,1-2H3 |
| InChIKey | XGMYNZDVFDKIGJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide?
The IUPAC name of 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide (CID 113303615) is 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide?
The canonical SMILES for 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide is CN(C)C(=O)CN1CCC(NCC(F)F)CC1.
What is the InChIKey of 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide?
The InChIKey is XGMYNZDVFDKIGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2N3O/c1-15(2)11(17)8-16-5-3-9(4-6-16)14-7-10(12)13/h9-10,14H,3-8H2,1-2H3.
What are the key properties of 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide?
2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide has a molecular weight of 249.30 g/mol, XLogP of 0.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2-difluoroethylamino)piperidin-1-yl]-N,N-dimethylacetamide is sourced from PubChem (CID 113303615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).