C12H25N3O2 — CID 43770571
2-[4-(3-hydroxypropylamino)piperidin-1-yl]-N,N-dimethylacetamide (PubChem CID 43770571) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[4-(3-hydroxypropylamino)piperidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(3-hydroxypropylamino)piperidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43770571 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 2-[4-(3-hydroxypropylamino)piperidin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCC(NCCCO)CC1 |
| InChI | InChI=1S/C12H25N3O2/c1-14(2)12(17)10-15-7-4-11(5-8-15)13-6-3-9-16/h11,13,16H,3-10H2,1-2H3 |
| InChIKey | QHJDEEBKSGPMHS-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|