C14H25N3O — CID 116643187
N,N-dimethyl-2-[4-(pent-3-ynylamino)piperidin-1-yl]acetamide (PubChem CID 116643187) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(pent-3-ynylamino)piperidin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[4-(pent-3-ynylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 116643187 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N,N-dimethyl-2-[4-(pent-3-ynylamino)piperidin-1-yl]acetamide |
| SMILES | CC#CCCNC1CCN(CC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C14H25N3O/c1-4-5-6-9-15-13-7-10-17(11-8-13)12-14(18)16(2)3/h13,15H,6-12H2,1-3H3 |
| InChIKey | PSLCGWSEXVNUMS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|