C12H21N3O — CID 83262365
4-(but-3-ynylamino)-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 83262365) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-(but-3-ynylamino)-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-(but-3-ynylamino)-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 83262365 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-(but-3-ynylamino)-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | C#CCCNC1CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C12H21N3O/c1-4-5-8-13-11-6-9-15(10-7-11)12(16)14(2)3/h1,11,13H,5-10H2,2-3H3 |
| InChIKey | MVWBPDXTOSEGFH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|