C15H31N3O2 — CID 83199097
N,N-dimethyl-4-[3-(2-methylpropoxy)propylamino]piperidine-1-carboxamide (PubChem CID 83199097) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-(2-methylpropoxy)propylamino]piperidine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-[3-(2-methylpropoxy)propylamino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 83199097 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | N,N-dimethyl-4-[3-(2-methylpropoxy)propylamino]piperidine-1-carboxamide |
| SMILES | CC(C)COCCCNC1CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C15H31N3O2/c1-13(2)12-20-11-5-8-16-14-6-9-18(10-7-14)15(19)17(3)4/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | QNHHTICAZJAIBJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|