C13H24F3NO — CID 115519605
4-(propylamino)-1-(4,4,4-trifluorobutyl)cyclohexan-1-ol (PubChem CID 115519605) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(propylamino)-1-(4,4,4-trifluorobutyl)cyclohexan-1-ol.
| Compound Name | 4-(propylamino)-1-(4,4,4-trifluorobutyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 115519605 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 4-(propylamino)-1-(4,4,4-trifluorobutyl)cyclohexan-1-ol |
| SMILES | CCCNC1CCC(O)(CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3NO/c1-2-10-17-11-4-8-12(18,9-5-11)6-3-7-13(14,15)16/h11,17-18H,2-10H2,1H3 |
| InChIKey | PKXQADOSYBITLH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |