C11H17F3OS — CID 171964307
3-(4,4,4-trifluorobutyl)-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171964307) has the molecular formula C11H17F3OS and a molecular weight of 254.32 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutyl)-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(4,4,4-trifluorobutyl)-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171964307 |
| Molecular Formula | C11H17F3OS |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3-(4,4,4-trifluorobutyl)-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(CCCC(F)(F)F)CC2CCC(C1)S2 |
| InChI | InChI=1S/C11H17F3OS/c12-11(13,14)5-1-4-10(15)6-8-2-3-9(7-10)16-8/h8-9,15H,1-7H2 |
| InChIKey | VGRUAHDMZWIESN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |