C7H13ClF3NO2S — CID 115521751
3-chloro-N-(4,4,4-trifluorobutyl)propane-1-sulfonamide (PubChem CID 115521751) has the molecular formula C7H13ClF3NO2S and a molecular weight of 267.70 g/mol. Its IUPAC name is 3-chloro-N-(4,4,4-trifluorobutyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(4,4,4-trifluorobutyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 115521751 |
| Molecular Formula | C7H13ClF3NO2S |
| Molecular Weight | 267.70 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-chloro-N-(4,4,4-trifluorobutyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NCCCC(F)(F)F |
| InChI | InChI=1S/C7H13ClF3NO2S/c8-4-2-6-15(13,14)12-5-1-3-7(9,10)11/h12H,1-6H2 |
| InChIKey | XKRRJWSVWQDOJG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|