About 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane
4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane (PubChem CID 88547149) has the molecular formula C7H12ClF3O2S
and a molecular weight of 252.68 g/mol. Its IUPAC name is 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane.
Molecular Properties
| Compound Name | 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane |
| PubChem CID | 88547149 |
| Molecular Formula | C7H12ClF3O2S |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane |
| SMILES | O=S(=O)(CCCCl)CCCC(F)(F)F |
| InChI | InChI=1S/C7H12ClF3O2S/c8-4-2-6-14(12,13)5-1-3-7(9,10)11/h1-6H2 |
| InChIKey | LUQRODOPBOHVJY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane?
The IUPAC name of 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane (CID 88547149) is 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane.
What is the SMILES notation for 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane?
The canonical SMILES for 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane is O=S(=O)(CCCCl)CCCC(F)(F)F.
What is the InChIKey of 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane?
The InChIKey is LUQRODOPBOHVJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClF3O2S/c8-4-2-6-14(12,13)5-1-3-7(9,10)11/h1-6H2.
What are the key properties of 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane?
4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane has a molecular weight of 252.68 g/mol, XLogP of 2.37, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane is sourced from PubChem (CID 88547149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).