C7H12ClF3O2S — CID 88547149
4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane (PubChem CID 88547149) has the molecular formula C7H12ClF3O2S and a molecular weight of 252.68 g/mol. Its IUPAC name is 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane.
| Compound Name | 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane |
|---|---|
| PubChem CID | 88547149 |
| Molecular Formula | C7H12ClF3O2S |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 4-(3-chloropropylsulfonyl)-1,1,1-trifluorobutane |
| SMILES | O=S(=O)(CCCCl)CCCC(F)(F)F |
| InChI | InChI=1S/C7H12ClF3O2S/c8-4-2-6-14(12,13)5-1-3-7(9,10)11/h1-6H2 |
| InChIKey | LUQRODOPBOHVJY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|