C6H11ClF3NO2S — CID 60890473
3-chloro-N-methyl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide (PubChem CID 60890473) has the molecular formula C6H11ClF3NO2S and a molecular weight of 253.67 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-methyl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60890473 |
| Molecular Formula | C6H11ClF3NO2S |
| Molecular Weight | 253.67 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 3-chloro-N-methyl-N-(2,2,2-trifluoroethyl)propane-1-sulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)CCCCl |
| InChI | InChI=1S/C6H11ClF3NO2S/c1-11(5-6(8,9)10)14(12,13)4-2-3-7/h2-5H2,1H3 |
| InChIKey | YTYVVIRBDQQIOO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|