C11H23ClN2O3S — CID 116815382
2-[4-chlorobutylsulfonyl(methyl)amino]-N,N-diethylacetamide (PubChem CID 116815382) has the molecular formula C11H23ClN2O3S and a molecular weight of 298.84 g/mol. Its IUPAC name is 2-[4-chlorobutylsulfonyl(methyl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[4-chlorobutylsulfonyl(methyl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 116815382 |
| Molecular Formula | C11H23ClN2O3S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[4-chlorobutylsulfonyl(methyl)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)S(=O)(=O)CCCCCl |
| InChI | InChI=1S/C11H23ClN2O3S/c1-4-14(5-2)11(15)10-13(3)18(16,17)9-7-6-8-12/h4-10H2,1-3H3 |
| InChIKey | YKSOHUPSVLOSDP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|