C9H17ClN2O2 — CID 60693102
2-[(2-chloroacetyl)-methylamino]-N,N-diethylacetamide (PubChem CID 60693102) has the molecular formula C9H17ClN2O2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(2-chloroacetyl)-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 60693102 |
| Molecular Formula | C9H17ClN2O2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(2-chloroacetyl)-methylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)CCl |
| InChI | InChI=1S/C9H17ClN2O2/c1-4-12(5-2)9(14)7-11(3)8(13)6-10/h4-7H2,1-3H3 |
| InChIKey | ZDDYFIWYXMKDBQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|