C11H23ClN2O4S — CID 116815328
2-[4-chlorobutylsulfonyl(2-methoxyethyl)amino]-N,N-dimethylacetamide (PubChem CID 116815328) has the molecular formula C11H23ClN2O4S and a molecular weight of 314.84 g/mol. Its IUPAC name is 2-[4-chlorobutylsulfonyl(2-methoxyethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[4-chlorobutylsulfonyl(2-methoxyethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 116815328 |
| Molecular Formula | C11H23ClN2O4S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[4-chlorobutylsulfonyl(2-methoxyethyl)amino]-N,N-dimethylacetamide |
| SMILES | COCCN(CC(=O)N(C)C)S(=O)(=O)CCCCCl |
| InChI | InChI=1S/C11H23ClN2O4S/c1-13(2)11(15)10-14(7-8-18-3)19(16,17)9-5-4-6-12/h4-10H2,1-3H3 |
| InChIKey | QPYXBHOXIIQWBL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|