C10H22N2O5S — CID 103862479
2-[2-(dimethylamino)ethyl-(3-methoxypropylsulfonyl)amino]acetic acid (PubChem CID 103862479) has the molecular formula C10H22N2O5S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-(3-methoxypropylsulfonyl)amino]acetic acid.
| Compound Name | 2-[2-(dimethylamino)ethyl-(3-methoxypropylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 103862479 |
| Molecular Formula | C10H22N2O5S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-(3-methoxypropylsulfonyl)amino]acetic acid |
| SMILES | COCCCS(=O)(=O)N(CCN(C)C)CC(=O)O |
| InChI | InChI=1S/C10H22N2O5S/c1-11(2)5-6-12(9-10(13)14)18(15,16)8-4-7-17-3/h4-9H2,1-3H3,(H,13,14) |
| InChIKey | XXLNBCSUTOCMFX-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|