C8H15ClF3NO2S — CID 107488814
N-(2-chloroethyl)-N-(2-ethylsulfonylethyl)-2,2,2-trifluoroethanamine (PubChem CID 107488814) has the molecular formula C8H15ClF3NO2S and a molecular weight of 281.73 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2-ethylsulfonylethyl)-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-chloroethyl)-N-(2-ethylsulfonylethyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107488814 |
| Molecular Formula | C8H15ClF3NO2S |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N-(2-chloroethyl)-N-(2-ethylsulfonylethyl)-2,2,2-trifluoroethanamine |
| SMILES | CCS(=O)(=O)CCN(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C8H15ClF3NO2S/c1-2-16(14,15)6-5-13(4-3-9)7-8(10,11)12/h2-7H2,1H3 |
| InChIKey | QDXFSMMZAHEUKX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|