C10H15ClF3N3 — CID 107489094
N-(2-chloroethyl)-2,2,2-trifluoro-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine (PubChem CID 107489094) has the molecular formula C10H15ClF3N3 and a molecular weight of 269.70 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2,2-trifluoro-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 107489094 |
| Molecular Formula | C10H15ClF3N3 |
| Molecular Weight | 269.70 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-[2-(1-methylpyrazol-4-yl)ethyl]ethanamine |
| SMILES | Cn1cc(CCN(CCCl)CC(F)(F)F)cn1 |
| InChI | InChI=1S/C10H15ClF3N3/c1-16-7-9(6-15-16)2-4-17(5-3-11)8-10(12,13)14/h6-7H,2-5,8H2,1H3 |
| InChIKey | PSDGBASZKKROGD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.70 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|