C9H11F3N2O — CID 103007322
1,1,1-trifluoro-5-(1-methylpyrazol-4-yl)pentan-3-one (PubChem CID 103007322) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-(1-methylpyrazol-4-yl)pentan-3-one.
| Compound Name | 1,1,1-trifluoro-5-(1-methylpyrazol-4-yl)pentan-3-one |
|---|---|
| PubChem CID | 103007322 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1,1,1-trifluoro-5-(1-methylpyrazol-4-yl)pentan-3-one |
| SMILES | Cn1cc(CCC(=O)CC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H11F3N2O/c1-14-6-7(5-13-14)2-3-8(15)4-9(10,11)12/h5-6H,2-4H2,1H3 |
| InChIKey | LFZGUGUBWOGISW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |