C15H15F3N2O — CID 103023880
4-(1-methylpyrazol-4-yl)-1-[4-(trifluoromethyl)phenyl]butan-2-one (PubChem CID 103023880) has the molecular formula C15H15F3N2O and a molecular weight of 296.29 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-1-[4-(trifluoromethyl)phenyl]butan-2-one.
| Compound Name | 4-(1-methylpyrazol-4-yl)-1-[4-(trifluoromethyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 103023880 |
| Molecular Formula | C15H15F3N2O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-1-[4-(trifluoromethyl)phenyl]butan-2-one |
| SMILES | Cn1cc(CCC(=O)Cc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C15H15F3N2O/c1-20-10-12(9-19-20)4-7-14(21)8-11-2-5-13(6-3-11)15(16,17)18/h2-3,5-6,9-10H,4,7-8H2,1H3 |
| InChIKey | UUJPGNVLQAYTEU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |