C14H14Cl2N2O — CID 103007346
1-(2,6-dichlorophenyl)-4-(1-methylpyrazol-4-yl)butan-2-one (PubChem CID 103007346) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.18 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-4-(1-methylpyrazol-4-yl)butan-2-one.
| Compound Name | 1-(2,6-dichlorophenyl)-4-(1-methylpyrazol-4-yl)butan-2-one |
|---|---|
| PubChem CID | 103007346 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-4-(1-methylpyrazol-4-yl)butan-2-one |
| SMILES | Cn1cc(CCC(=O)Cc2c(Cl)cccc2Cl)cn1 |
| InChI | InChI=1S/C14H14Cl2N2O/c1-18-9-10(8-17-18)5-6-11(19)7-12-13(15)3-2-4-14(12)16/h2-4,8-9H,5-7H2,1H3 |
| InChIKey | QXTZEDBQBVEYSL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |