About N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine
N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine (PubChem CID 107489191) has the molecular formula C9H13ClF3N3
and a molecular weight of 255.67 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine |
| PubChem CID | 107489191 |
| Molecular Formula | C9H13ClF3N3 |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine |
| SMILES | Cn1ccc(CN(CCCl)CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H13ClF3N3/c1-15-4-2-8(14-15)6-16(5-3-10)7-9(11,12)13/h2,4H,3,5-7H2,1H3 |
| InChIKey | NUQLUPSYRCWVJJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine?
The IUPAC name of N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine (CID 107489191) is N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine.
What is the SMILES notation for N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine?
The canonical SMILES for N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine is Cn1ccc(CN(CCCl)CC(F)(F)F)n1.
What is the InChIKey of N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine?
The InChIKey is NUQLUPSYRCWVJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClF3N3/c1-15-4-2-8(14-15)6-16(5-3-10)7-9(11,12)13/h2,4H,3,5-7H2,1H3.
What are the key properties of N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine?
N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine has a molecular weight of 255.67 g/mol, XLogP of 2.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-2,2,2-trifluoro-N-[(1-methylpyrazol-3-yl)methyl]ethanamine is sourced from PubChem (CID 107489191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).