C11H20ClN3 — CID 82871800
3-chloro-N-[(1-methylpyrazol-3-yl)methyl]-N-propan-2-ylpropan-1-amine (PubChem CID 82871800) has the molecular formula C11H20ClN3 and a molecular weight of 229.75 g/mol. Its IUPAC name is 3-chloro-N-[(1-methylpyrazol-3-yl)methyl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-chloro-N-[(1-methylpyrazol-3-yl)methyl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 82871800 |
| Molecular Formula | C11H20ClN3 |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 3-chloro-N-[(1-methylpyrazol-3-yl)methyl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)N(CCCCl)Cc1ccn(C)n1 |
| InChI | InChI=1S/C11H20ClN3/c1-10(2)15(7-4-6-12)9-11-5-8-14(3)13-11/h5,8,10H,4,6-7,9H2,1-3H3 |
| InChIKey | YRXOKGFAUYFYPU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|