C11H14ClF3N2O — CID 107489225
N-(2-chloroethyl)-2,2,2-trifluoro-N-[(6-methoxy-2-pyridinyl)methyl]ethanamine (PubChem CID 107489225) has the molecular formula C11H14ClF3N2O and a molecular weight of 282.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2,2-trifluoro-N-[(6-methoxy-2-pyridinyl)methyl]ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-[(6-methoxy-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107489225 |
| Molecular Formula | C11H14ClF3N2O |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-[(6-methoxy-2-pyridinyl)methyl]ethanamine |
| SMILES | COc1cccc(CN(CCCl)CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H14ClF3N2O/c1-18-10-4-2-3-9(16-10)7-17(6-5-12)8-11(13,14)15/h2-4H,5-8H2,1H3 |
| InChIKey | OAIAUCYZPBWQKP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|