C13H17ClF3NO2 — CID 107489039
N-(2-chloroethyl)-N-[(3,4-dimethoxyphenyl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 107489039) has the molecular formula C13H17ClF3NO2 and a molecular weight of 311.73 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(3,4-dimethoxyphenyl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-chloroethyl)-N-[(3,4-dimethoxyphenyl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107489039 |
| Molecular Formula | C13H17ClF3NO2 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-chloroethyl)-N-[(3,4-dimethoxyphenyl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | COc1ccc(CN(CCCl)CC(F)(F)F)cc1OC |
| InChI | InChI=1S/C13H17ClF3NO2/c1-19-11-4-3-10(7-12(11)20-2)8-18(6-5-14)9-13(15,16)17/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | ABQVWZWLUZNXDL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|