C12H17ClN2O3 — CID 21140395
1-(2-chloroethyl)-1-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 21140395) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 1-(2-chloroethyl)-1-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 1-(2-chloroethyl)-1-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 21140395 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1-(2-chloroethyl)-1-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CN(CCCl)C(N)=O)cc1OC |
| InChI | InChI=1S/C12H17ClN2O3/c1-17-10-4-3-9(7-11(10)18-2)8-15(6-5-13)12(14)16/h3-4,7H,5-6,8H2,1-2H3,(H2,14,16) |
| InChIKey | BVBALRAONRBBCG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|