C16H25NO3 — CID 71106778
N-[(3,4-dimethoxyphenyl)methyl]-N-propylbutanamide (PubChem CID 71106778) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-propylbutanamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-propylbutanamide |
|---|---|
| PubChem CID | 71106778 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-propylbutanamide |
| SMILES | CCCC(=O)N(CCC)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H25NO3/c1-5-7-16(18)17(10-6-2)12-13-8-9-14(19-3)15(11-13)20-4/h8-9,11H,5-7,10,12H2,1-4H3 |
| InChIKey | PXHYEAUHECITRD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |