C24H33NO4 — CID 55455967
2-(3-methoxy-4-methylphenyl)-N-[(3-methoxy-4-propoxyphenyl)methyl]-N-propylacetamide (PubChem CID 55455967) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is 2-(3-methoxy-4-methylphenyl)-N-[(3-methoxy-4-propoxyphenyl)methyl]-N-propylacetamide.
| Compound Name | 2-(3-methoxy-4-methylphenyl)-N-[(3-methoxy-4-propoxyphenyl)methyl]-N-propylacetamide |
|---|---|
| PubChem CID | 55455967 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 2-(3-methoxy-4-methylphenyl)-N-[(3-methoxy-4-propoxyphenyl)methyl]-N-propylacetamide |
| SMILES | CCCOc1ccc(CN(CCC)C(=O)Cc2ccc(C)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H33NO4/c1-6-12-25(24(26)16-19-9-8-18(3)22(14-19)27-4)17-20-10-11-21(29-13-7-2)23(15-20)28-5/h8-11,14-15H,6-7,12-13,16-17H2,1-5H3 |
| InChIKey | OBEQQGMSHQZWFT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |