C17H24F3NO3S — CID 55666830
N-[(3-methoxy-4-propoxyphenyl)methyl]-N-propyl-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 55666830) has the molecular formula C17H24F3NO3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[(3-methoxy-4-propoxyphenyl)methyl]-N-propyl-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[(3-methoxy-4-propoxyphenyl)methyl]-N-propyl-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55666830 |
| Molecular Formula | C17H24F3NO3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[(3-methoxy-4-propoxyphenyl)methyl]-N-propyl-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | CCCOc1ccc(CN(CCC)C(=O)CSC(F)(F)F)cc1OC |
| InChI | InChI=1S/C17H24F3NO3S/c1-4-8-21(16(22)12-25-17(18,19)20)11-13-6-7-14(24-9-5-2)15(10-13)23-3/h6-7,10H,4-5,8-9,11-12H2,1-3H3 |
| InChIKey | PPYRMHQGMLVZSP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |