C24H28N2O5 — CID 55332708
N-[(3-methoxy-4-propoxyphenyl)methyl]-2-methyl-1,3-dioxo-N-propylisoindole-5-carboxamide (PubChem CID 55332708) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[(3-methoxy-4-propoxyphenyl)methyl]-2-methyl-1,3-dioxo-N-propylisoindole-5-carboxamide.
| Compound Name | N-[(3-methoxy-4-propoxyphenyl)methyl]-2-methyl-1,3-dioxo-N-propylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55332708 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[(3-methoxy-4-propoxyphenyl)methyl]-2-methyl-1,3-dioxo-N-propylisoindole-5-carboxamide |
| SMILES | CCCOc1ccc(CN(CCC)C(=O)c2ccc3c(c2)C(=O)N(C)C3=O)cc1OC |
| InChI | InChI=1S/C24H28N2O5/c1-5-11-26(15-16-7-10-20(31-12-6-2)21(13-16)30-4)22(27)17-8-9-18-19(14-17)24(29)25(3)23(18)28/h7-10,13-14H,5-6,11-12,15H2,1-4H3 |
| InChIKey | SFDRAGAXDMNFCS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|