C17H27NO5S — CID 110416390
3-(3,4-dimethoxyphenyl)sulfonyl-N,N-dipropylpropanamide (PubChem CID 110416390) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)sulfonyl-N,N-dipropylpropanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)sulfonyl-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 110416390 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)sulfonyl-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H27NO5S/c1-5-10-18(11-6-2)17(19)9-12-24(20,21)14-7-8-15(22-3)16(13-14)23-4/h7-8,13H,5-6,9-12H2,1-4H3 |
| InChIKey | UQRCSYPLKPTWKJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |