C15H23NO5S — CID 110414798
3-(3,4-dimethoxyphenyl)sulfonyl-N,N-diethylpropanamide (PubChem CID 110414798) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)sulfonyl-N,N-diethylpropanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)sulfonyl-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 110414798 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)sulfonyl-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCS(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23NO5S/c1-5-16(6-2)15(17)9-10-22(18,19)12-7-8-13(20-3)14(11-12)21-4/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | MZPPFFGMDAQRLW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |