C18H21NO5S — CID 110422910
3-(benzenesulfonyl)-N-(3,4-dimethoxyphenyl)-N-methylpropanamide (PubChem CID 110422910) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(3,4-dimethoxyphenyl)-N-methylpropanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(3,4-dimethoxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 110422910 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(3,4-dimethoxyphenyl)-N-methylpropanamide |
| SMILES | COc1ccc(N(C)C(=O)CCS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H21NO5S/c1-19(14-9-10-16(23-2)17(13-14)24-3)18(20)11-12-25(21,22)15-7-5-4-6-8-15/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | HJKXXHJNXROOLS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |