C13H17NO5S — CID 62627813
2-[3-(benzenesulfonyl)propanoyl-methylamino]propanoic acid (PubChem CID 62627813) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)propanoyl-methylamino]propanoic acid.
| Compound Name | 2-[3-(benzenesulfonyl)propanoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62627813 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[3-(benzenesulfonyl)propanoyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO5S/c1-10(13(16)17)14(2)12(15)8-9-20(18,19)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | UVSAAHAFUIUMPE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |