C13H19NO4S — CID 60740141
3-(benzenesulfonyl)-N-ethyl-N-(2-hydroxyethyl)propanamide (PubChem CID 60740141) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-ethyl-N-(2-hydroxyethyl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-ethyl-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 60740141 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-(benzenesulfonyl)-N-ethyl-N-(2-hydroxyethyl)propanamide |
| SMILES | CCN(CCO)C(=O)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO4S/c1-2-14(9-10-15)13(16)8-11-19(17,18)12-6-4-3-5-7-12/h3-7,15H,2,8-11H2,1H3 |
| InChIKey | LUFQAXFHEZCQFT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |