C20H30N2O3S — CID 134714538
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(benzenesulfonyl)-N-methylpropanamide (PubChem CID 134714538) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(benzenesulfonyl)-N-methylpropanamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(benzenesulfonyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 134714538 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(benzenesulfonyl)-N-methylpropanamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)CCS(=O)(=O)c3ccccc3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H30N2O3S/c1-21(2)17-11-15-13-18(14-16(15)12-17)22(3)20(23)9-10-26(24,25)19-7-5-4-6-8-19/h4-8,15-18H,9-14H2,1-3H3/t15-,16+,17?,18? |
| InChIKey | OBRNLNBGNZNNAB-OQSMONGASA-N |
| XLogP | 2.43 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |