C20H27F3N2O — CID 134713031
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 134713031) has the molecular formula C20H27F3N2O and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 134713031 |
| Molecular Formula | C20H27F3N2O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)Cc3ccc(C(F)(F)F)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H27F3N2O/c1-24(2)17-9-14-11-18(12-15(14)10-17)25(3)19(26)8-13-4-6-16(7-5-13)20(21,22)23/h4-7,14-15,17-18H,8-12H2,1-3H3/t14-,15+,17?,18? |
| InChIKey | GLFYMYIKMDKHOV-BXXOZEPKSA-N |
| XLogP | 3.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |