C18H28N2OS — CID 134703703
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-3-thiophen-3-ylpropanamide (PubChem CID 134703703) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-3-thiophen-3-ylpropanamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 134703703 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-3-thiophen-3-ylpropanamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)CCc3ccsc3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H28N2OS/c1-19(2)16-8-14-10-17(11-15(14)9-16)20(3)18(21)5-4-13-6-7-22-12-13/h6-7,12,14-17H,4-5,8-11H2,1-3H3/t14-,15+,16?,17? |
| InChIKey | BRPRNRAFMMPDRJ-RYTJFDOTSA-N |
| XLogP | 3.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |