C20H29ClN2O — CID 134704943
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(3-chlorophenyl)-N-methylpropanamide (PubChem CID 134704943) has the molecular formula C20H29ClN2O and a molecular weight of 348.92 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(3-chlorophenyl)-N-methylpropanamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(3-chlorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 134704943 |
| Molecular Formula | C20H29ClN2O |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(3-chlorophenyl)-N-methylpropanamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)CCc3cccc(Cl)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H29ClN2O/c1-22(2)18-10-15-12-19(13-16(15)11-18)23(3)20(24)8-7-14-5-4-6-17(21)9-14/h4-6,9,15-16,18-19H,7-8,10-13H2,1-3H3/t15-,16+,18?,19? |
| InChIKey | WYNOXVBHLRNQPJ-CCZBSFLLSA-N |
| XLogP | 3.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |